About hydron;phosphonatoformamide;trimethylazanium
hydron;phosphonatoformamide;trimethylazanium (PubChem CID 21391373) has the molecular formula C4H13N2O4P
and a molecular weight of 184.13 g/mol. Its IUPAC name is hydron;phosphonatoformamide;trimethylazanium.
Molecular Properties
| Compound Name | hydron;phosphonatoformamide;trimethylazanium |
| PubChem CID | 21391373 |
| Molecular Formula | C4H13N2O4P |
| Molecular Weight | 184.13 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | hydron;phosphonatoformamide;trimethylazanium |
| SMILES | C[NH+](C)C.NC(=O)P(=O)([O-])[O-].[H+] |
| InChI | InChI=1S/C3H9N.CH4NO4P/c1-4(2)3;2-1(3)7(4,5)6/h1-3H3;(H2,2,3)(H2,4,5,6) |
| InChIKey | IYRFCIGFHPRKAO-UHFFFAOYSA-N |
| XLogP | -3.15 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.13 |
| LogP ≤ 5 | -3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hydron;phosphonatoformamide;trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;phosphonatoformamide;trimethylazanium?
The IUPAC name of hydron;phosphonatoformamide;trimethylazanium (CID 21391373) is hydron;phosphonatoformamide;trimethylazanium.
What is the SMILES notation for hydron;phosphonatoformamide;trimethylazanium?
The canonical SMILES for hydron;phosphonatoformamide;trimethylazanium is C[NH+](C)C.NC(=O)P(=O)([O-])[O-].[H+].
What is the InChIKey of hydron;phosphonatoformamide;trimethylazanium?
The InChIKey is IYRFCIGFHPRKAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.CH4NO4P/c1-4(2)3;2-1(3)7(4,5)6/h1-3H3;(H2,2,3)(H2,4,5,6).
What are the key properties of hydron;phosphonatoformamide;trimethylazanium?
hydron;phosphonatoformamide;trimethylazanium has a molecular weight of 184.13 g/mol, XLogP of -3.15, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;phosphonatoformamide;trimethylazanium is sourced from PubChem (CID 21391373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).