About hydron;2-hydroxyethylazanium;phosphonatoformamide
hydron;2-hydroxyethylazanium;phosphonatoformamide (PubChem CID 21391394) has the molecular formula C3H11N2O5P
and a molecular weight of 186.10 g/mol. Its IUPAC name is hydron;2-hydroxyethylazanium;phosphonatoformamide.
Molecular Properties
| Compound Name | hydron;2-hydroxyethylazanium;phosphonatoformamide |
| PubChem CID | 21391394 |
| Molecular Formula | C3H11N2O5P |
| Molecular Weight | 186.10 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | hydron;2-hydroxyethylazanium;phosphonatoformamide |
| SMILES | NC(=O)P(=O)([O-])[O-].[H+].[NH3+]CCO |
| InChI | InChI=1S/C2H7NO.CH4NO4P/c3-1-2-4;2-1(3)7(4,5)6/h4H,1-3H2;(H2,2,3)(H2,4,5,6) |
| InChIKey | PNLHIDSMPHCWAW-UHFFFAOYSA-N |
| XLogP | -3.69 |
| TPSA | 154.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.10 |
| LogP ≤ 5 | -3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hydron;2-hydroxyethylazanium;phosphonatoformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;2-hydroxyethylazanium;phosphonatoformamide?
The IUPAC name of hydron;2-hydroxyethylazanium;phosphonatoformamide (CID 21391394) is hydron;2-hydroxyethylazanium;phosphonatoformamide.
What is the SMILES notation for hydron;2-hydroxyethylazanium;phosphonatoformamide?
The canonical SMILES for hydron;2-hydroxyethylazanium;phosphonatoformamide is NC(=O)P(=O)([O-])[O-].[H+].[NH3+]CCO.
What is the InChIKey of hydron;2-hydroxyethylazanium;phosphonatoformamide?
The InChIKey is PNLHIDSMPHCWAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H7NO.CH4NO4P/c3-1-2-4;2-1(3)7(4,5)6/h4H,1-3H2;(H2,2,3)(H2,4,5,6).
What are the key properties of hydron;2-hydroxyethylazanium;phosphonatoformamide?
hydron;2-hydroxyethylazanium;phosphonatoformamide has a molecular weight of 186.10 g/mol, XLogP of -3.69, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;2-hydroxyethylazanium;phosphonatoformamide is sourced from PubChem (CID 21391394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).