C8H22N2O9 — CID 169452292
(2R,3R)-2,3-dihydroxybutanedioate;bis(2-hydroxyethylazanium);hydrate (PubChem CID 169452292) has the molecular formula C8H22N2O9 and a molecular weight of 290.27 g/mol. Its IUPAC name is (2R,3R)-2,3-dihydroxybutanedioate;bis(2-hydroxyethylazanium);hydrate.
| Compound Name | (2R,3R)-2,3-dihydroxybutanedioate;bis(2-hydroxyethylazanium);hydrate |
|---|---|
| PubChem CID | 169452292 |
| Molecular Formula | C8H22N2O9 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | (2R,3R)-2,3-dihydroxybutanedioate;bis(2-hydroxyethylazanium);hydrate |
| SMILES | O.O=C([O-])[C@H](O)[C@@H](O)C(=O)[O-].[NH3+]CCO.[NH3+]CCO |
| InChI | InChI=1S/C4H6O6.2C2H7NO.H2O/c5-1(3(7)8)2(6)4(9)10;2*3-1-2-4;/h1-2,5-6H,(H,7,8)(H,9,10);2*4H,1-3H2;1H2/t1-,2-;;;/m1.../s1 |
| InChIKey | NYBGEOXPJWPSNA-QXMMYYGRSA-N |
| XLogP | -9.18 |
| TPSA | 247.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | -9.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |