C26H34N4 — CID 173454823
2-[[(1E,4E)-1,5-bis(4-propan-2-ylphenyl)penta-1,4-dien-3-ylidene]amino]-1,1-dimethylguanidine (PubChem CID 173454823) has the molecular formula C26H34N4 and a molecular weight of 402.59 g/mol. Its IUPAC name is 2-[[(1E,4E)-1,5-bis(4-propan-2-ylphenyl)penta-1,4-dien-3-ylidene]amino]-1,1-dimethylguanidine.
| Compound Name | 2-[[(1E,4E)-1,5-bis(4-propan-2-ylphenyl)penta-1,4-dien-3-ylidene]amino]-1,1-dimethylguanidine |
|---|---|
| PubChem CID | 173454823 |
| Molecular Formula | C26H34N4 |
| Molecular Weight | 402.59 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | 2-[[(1E,4E)-1,5-bis(4-propan-2-ylphenyl)penta-1,4-dien-3-ylidene]amino]-1,1-dimethylguanidine |
| SMILES | CC(C)c1ccc(/C=C/C(/C=C/c2ccc(C(C)C)cc2)=NN=C(N)N(C)C)cc1 |
| InChI | InChI=1S/C26H34N4/c1-19(2)23-13-7-21(8-14-23)11-17-25(28-29-26(27)30(5)6)18-12-22-9-15-24(16-10-22)20(3)4/h7-20H,1-6H3,(H2,27,29)/b17-11+,18-12+ |
| InChIKey | DUSRBAPTXLYZET-JYFOCSDGSA-N |
| XLogP | 5.89 |
| TPSA | 53.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.59 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|