C19H33NO2 — CID 173456397
acetic acid;2-(2-octylphenyl)propan-2-amine (PubChem CID 173456397) has the molecular formula C19H33NO2 and a molecular weight of 307.48 g/mol. Its IUPAC name is acetic acid;2-(2-octylphenyl)propan-2-amine.
| Compound Name | acetic acid;2-(2-octylphenyl)propan-2-amine |
|---|---|
| PubChem CID | 173456397 |
| Molecular Formula | C19H33NO2 |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.25 |
| IUPAC Name | acetic acid;2-(2-octylphenyl)propan-2-amine |
| SMILES | CC(=O)O.CCCCCCCCc1ccccc1C(C)(C)N |
| InChI | InChI=1S/C17H29N.C2H4O2/c1-4-5-6-7-8-9-12-15-13-10-11-14-16(15)17(2,3)18;1-2(3)4/h10-11,13-14H,4-9,12,18H2,1-3H3;1H3,(H,3,4) |
| InChIKey | PUDAINFKCPYEEG-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|