C8H8K2O4S4 — CID 173457214
dipotassium;hydride;2,3,5,6-tetrakis(sulfanyl)terephthalic acid (PubChem CID 173457214) has the molecular formula C8H8K2O4S4 and a molecular weight of 374.61 g/mol. Its IUPAC name is dipotassium;hydride;2,3,5,6-tetrakis(sulfanyl)terephthalic acid.
| Compound Name | dipotassium;hydride;2,3,5,6-tetrakis(sulfanyl)terephthalic acid |
|---|---|
| PubChem CID | 173457214 |
| Molecular Formula | C8H8K2O4S4 |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 373.86 |
| IUPAC Name | dipotassium;hydride;2,3,5,6-tetrakis(sulfanyl)terephthalic acid |
| SMILES | O=C(O)c1c(S)c(S)c(C(=O)O)c(S)c1S.[H-].[H-].[K+].[K+] |
| InChI | InChI=1S/C8H6O4S4.2K.2H/c9-7(10)1-3(13)5(15)2(8(11)12)6(16)4(1)14;;;;/h13-16H,(H,9,10)(H,11,12);;;;/q;2*+1;2*-1 |
| InChIKey | ZTEFDYVZBQHAJT-UHFFFAOYSA-N |
| XLogP | -3.53 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | -3.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|