C18H35NaO6S — CID 173458027
sodium;hydride;sulfo (Z,12R)-12-hydroxyoctadec-9-enoate (PubChem CID 173458027) has the molecular formula C18H35NaO6S and a molecular weight of 402.53 g/mol. Its IUPAC name is sodium;hydride;sulfo (Z,12R)-12-hydroxyoctadec-9-enoate.
| Compound Name | sodium;hydride;sulfo (Z,12R)-12-hydroxyoctadec-9-enoate |
|---|---|
| PubChem CID | 173458027 |
| Molecular Formula | C18H35NaO6S |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | sodium;hydride;sulfo (Z,12R)-12-hydroxyoctadec-9-enoate |
| SMILES | CCCCCC[C@@H](O)C/C=C\CCCCCCCC(=O)OS(=O)(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C18H34O6S.Na.H/c1-2-3-4-11-14-17(19)15-12-9-7-5-6-8-10-13-16-18(20)24-25(21,22)23;;/h9,12,17,19H,2-8,10-11,13-16H2,1H3,(H,21,22,23);;/q;+1;-1/b12-9-;;/t17-;;/m1../s1 |
| InChIKey | GLKNZOZOFHFXPI-GKKIQAINSA-N |
| XLogP | 1.46 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|