About [methyl(trisilyloxysilyloxy)silyl] trisilyl silicate
[methyl(trisilyloxysilyloxy)silyl] trisilyl silicate (PubChem CID 173464332) has the molecular formula CH22O8Si9
and a molecular weight of 414.95 g/mol. Its IUPAC name is [methyl(trisilyloxysilyloxy)silyl] trisilyl silicate.
Molecular Properties
| Compound Name | [methyl(trisilyloxysilyloxy)silyl] trisilyl silicate |
| PubChem CID | 173464332 |
| Molecular Formula | CH22O8Si9 |
| Molecular Weight | 414.95 g/mol |
| Exact Mass | 413.92 |
| IUPAC Name | [methyl(trisilyloxysilyloxy)silyl] trisilyl silicate |
| SMILES | C[SiH](O[Si](O[SiH3])(O[SiH3])O[SiH3])O[Si](O[SiH3])(O[SiH3])O[SiH3] |
| InChI | InChI=1S/CH22O8Si9/c1-16(8-17(2-10,3-11)4-12)9-18(5-13,6-14)7-15/h16H,1,10-15H3 |
| InChIKey | XRVZFPUTAIIUJF-UHFFFAOYSA-N |
| XLogP | -8.48 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.95 |
| LogP ≤ 5 | -8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [methyl(trisilyloxysilyloxy)silyl] trisilyl silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [methyl(trisilyloxysilyloxy)silyl] trisilyl silicate?
The IUPAC name of [methyl(trisilyloxysilyloxy)silyl] trisilyl silicate (CID 173464332) is [methyl(trisilyloxysilyloxy)silyl] trisilyl silicate.
What is the SMILES notation for [methyl(trisilyloxysilyloxy)silyl] trisilyl silicate?
The canonical SMILES for [methyl(trisilyloxysilyloxy)silyl] trisilyl silicate is C[SiH](O[Si](O[SiH3])(O[SiH3])O[SiH3])O[Si](O[SiH3])(O[SiH3])O[SiH3].
What is the InChIKey of [methyl(trisilyloxysilyloxy)silyl] trisilyl silicate?
The InChIKey is XRVZFPUTAIIUJF-UHFFFAOYSA-N. The full InChI is InChI=1S/CH22O8Si9/c1-16(8-17(2-10,3-11)4-12)9-18(5-13,6-14)7-15/h16H,1,10-15H3.
What are the key properties of [methyl(trisilyloxysilyloxy)silyl] trisilyl silicate?
[methyl(trisilyloxysilyloxy)silyl] trisilyl silicate has a molecular weight of 414.95 g/mol, XLogP of -8.48, 10 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [methyl(trisilyloxysilyloxy)silyl] trisilyl silicate is sourced from PubChem (CID 173464332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).