C18H24F2N2O2S — CID 173466372
2-[(2,5-difluorophenyl)-methylidene-λ4-sulfanyl]-N-[(Z)-3-hydroxy-4,4-dimethylpent-2-enimidoyl]-2-methylpropanamide (PubChem CID 173466372) has the molecular formula C18H24F2N2O2S and a molecular weight of 370.47 g/mol. Its IUPAC name is 2-[(2,5-difluorophenyl)-methylidene-λ4-sulfanyl]-N-[(Z)-3-hydroxy-4,4-dimethylpent-2-enimidoyl]-2-methylpropanamide.
| Compound Name | 2-[(2,5-difluorophenyl)-methylidene-λ4-sulfanyl]-N-[(Z)-3-hydroxy-4,4-dimethylpent-2-enimidoyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 173466372 |
| Molecular Formula | C18H24F2N2O2S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 2-[(2,5-difluorophenyl)-methylidene-λ4-sulfanyl]-N-[(Z)-3-hydroxy-4,4-dimethylpent-2-enimidoyl]-2-methylpropanamide |
| SMILES | [H]/N=C(\C=C(/O)C(C)(C)C)NC(=O)C(C)(C)S(=C)c1cc(F)ccc1F |
| InChI | InChI=1S/C18H24F2N2O2S/c1-17(2,3)14(23)10-15(21)22-16(24)18(4,5)25(6)13-9-11(19)7-8-12(13)20/h7-10,23H,6H2,1-5H3,(H2,21,22,24)/b14-10- |
| InChIKey | HKRVLEPUQGQMLW-UVTDQMKNSA-N |
| XLogP | 4.38 |
| TPSA | 73.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|