C7H11F2N — CID 173467536
N-[(E)-1,3-difluorobut-1-enyl]propan-1-imine (PubChem CID 173467536) has the molecular formula C7H11F2N and a molecular weight of 147.17 g/mol. Its IUPAC name is N-[(E)-1,3-difluorobut-1-enyl]propan-1-imine.
| Compound Name | N-[(E)-1,3-difluorobut-1-enyl]propan-1-imine |
|---|---|
| PubChem CID | 173467536 |
| Molecular Formula | C7H11F2N |
| Molecular Weight | 147.17 g/mol |
| Exact Mass | 147.09 |
| IUPAC Name | N-[(E)-1,3-difluorobut-1-enyl]propan-1-imine |
| SMILES | CCC=N/C(F)=C\C(C)F |
| InChI | InChI=1S/C7H11F2N/c1-3-4-10-7(9)5-6(2)8/h4-6H,3H2,1-2H3/b7-5-,10-4? |
| InChIKey | ZUJZIXNBDFSXJP-MKTAXQDUSA-N |
| XLogP | 2.64 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.17 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|