C7H8F2N2 — CID 142136549
(1Z,3Z,5E)-2,5-difluoro-7-methyl-2,7-dihydro-1,4-diazocine (PubChem CID 142136549) has the molecular formula C7H8F2N2 and a molecular weight of 158.15 g/mol. Its IUPAC name is (1Z,3Z,5E)-2,5-difluoro-7-methyl-2,7-dihydro-1,4-diazocine.
| Compound Name | (1Z,3Z,5E)-2,5-difluoro-7-methyl-2,7-dihydro-1,4-diazocine |
|---|---|
| PubChem CID | 142136549 |
| Molecular Formula | C7H8F2N2 |
| Molecular Weight | 158.15 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | (1Z,3Z,5E)-2,5-difluoro-7-methyl-2,7-dihydro-1,4-diazocine |
| SMILES | CC1/C=N\C(F)/C=N\C(F)=C/1 |
| InChI | InChI=1S/C7H8F2N2/c1-5-2-6(8)11-4-7(9)10-3-5/h2-5,7H,1H3/b6-2-,10-3-,11-4- |
| InChIKey | QRIVJOHQSKHQLB-WBLLIKBBSA-N |
| XLogP | 1.88 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.15 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|