C22H32O4 — CID 173468048
(2,5-dimethyl-2-adamantyl) (E)-2-methyl-4-(2-methylprop-2-enoyloxy)pent-3-enoate (PubChem CID 173468048) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is (2,5-dimethyl-2-adamantyl) (E)-2-methyl-4-(2-methylprop-2-enoyloxy)pent-3-enoate.
| Compound Name | (2,5-dimethyl-2-adamantyl) (E)-2-methyl-4-(2-methylprop-2-enoyloxy)pent-3-enoate |
|---|---|
| PubChem CID | 173468048 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | (2,5-dimethyl-2-adamantyl) (E)-2-methyl-4-(2-methylprop-2-enoyloxy)pent-3-enoate |
| SMILES | C=C(C)C(=O)O/C(C)=C/C(C)C(=O)OC1(C)C2CC3CC1CC(C)(C3)C2 |
| InChI | InChI=1S/C22H32O4/c1-13(2)19(23)25-15(4)7-14(3)20(24)26-22(6)17-8-16-9-18(22)12-21(5,10-16)11-17/h7,14,16-18H,1,8-12H2,2-6H3/b15-7+ |
| InChIKey | WTGRODYLLSBDEN-VIZOYTHASA-N |
| XLogP | 4.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|