C12H8Cl3N — CID 173468894
2-benzyl-3,4,5-trichloropyridine (PubChem CID 173468894) has the molecular formula C12H8Cl3N and a molecular weight of 272.56 g/mol. Its IUPAC name is 2-benzyl-3,4,5-trichloropyridine.
| Compound Name | 2-benzyl-3,4,5-trichloropyridine |
|---|---|
| PubChem CID | 173468894 |
| Molecular Formula | C12H8Cl3N |
| Molecular Weight | 272.56 g/mol |
| Exact Mass | 270.97 |
| IUPAC Name | 2-benzyl-3,4,5-trichloropyridine |
| SMILES | Clc1cnc(Cc2ccccc2)c(Cl)c1Cl |
| InChI | InChI=1S/C12H8Cl3N/c13-9-7-16-10(12(15)11(9)14)6-8-4-2-1-3-5-8/h1-5,7H,6H2 |
| InChIKey | UBRDSCHEBMTGPZ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |