C11H9Cl2N — CID 122442244
2-benzyl-3,4-dichloro-1H-pyrrole (PubChem CID 122442244) has the molecular formula C11H9Cl2N and a molecular weight of 226.11 g/mol. Its IUPAC name is 2-benzyl-3,4-dichloro-1H-pyrrole.
| Compound Name | 2-benzyl-3,4-dichloro-1H-pyrrole |
|---|---|
| PubChem CID | 122442244 |
| Molecular Formula | C11H9Cl2N |
| Molecular Weight | 226.11 g/mol |
| Exact Mass | 225.01 |
| IUPAC Name | 2-benzyl-3,4-dichloro-1H-pyrrole |
| SMILES | Clc1c[nH]c(Cc2ccccc2)c1Cl |
| InChI | InChI=1S/C11H9Cl2N/c12-9-7-14-10(11(9)13)6-8-4-2-1-3-5-8/h1-5,7,14H,6H2 |
| InChIKey | DJFANUDYQPSYRI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.11 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |