C15H15ClN2S — CID 57068846
2-benzyl-5-chloro-N,N-dimethylpyridine-3-carbothioamide (PubChem CID 57068846) has the molecular formula C15H15ClN2S and a molecular weight of 290.82 g/mol. Its IUPAC name is 2-benzyl-5-chloro-N,N-dimethylpyridine-3-carbothioamide.
| Compound Name | 2-benzyl-5-chloro-N,N-dimethylpyridine-3-carbothioamide |
|---|---|
| PubChem CID | 57068846 |
| Molecular Formula | C15H15ClN2S |
| Molecular Weight | 290.82 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 2-benzyl-5-chloro-N,N-dimethylpyridine-3-carbothioamide |
| SMILES | CN(C)C(=S)c1cc(Cl)cnc1Cc1ccccc1 |
| InChI | InChI=1S/C15H15ClN2S/c1-18(2)15(19)13-9-12(16)10-17-14(13)8-11-6-4-3-5-7-11/h3-7,9-10H,8H2,1-2H3 |
| InChIKey | NZYODPBLMYAMLA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.82 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|