About (3-fluorophenyl) thiohypobromite
(3-fluorophenyl) thiohypobromite (PubChem CID 173469120) has the molecular formula C6H4BrFS
and a molecular weight of 207.07 g/mol. Its IUPAC name is (3-fluorophenyl) thiohypobromite.
Molecular Properties
| Compound Name | (3-fluorophenyl) thiohypobromite |
| PubChem CID | 173469120 |
| Molecular Formula | C6H4BrFS |
| Molecular Weight | 207.07 g/mol |
| Exact Mass | 205.92 |
| IUPAC Name | (3-fluorophenyl) thiohypobromite |
| SMILES | Fc1cccc(SBr)c1 |
| InChI | InChI=1S/C6H4BrFS/c7-9-6-3-1-2-5(8)4-6/h1-4H |
| InChIKey | XRSUWXXMFJKAQQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.07 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3-fluorophenyl) thiohypobromite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-fluorophenyl) thiohypobromite?
The IUPAC name of (3-fluorophenyl) thiohypobromite (CID 173469120) is (3-fluorophenyl) thiohypobromite.
What is the SMILES notation for (3-fluorophenyl) thiohypobromite?
The canonical SMILES for (3-fluorophenyl) thiohypobromite is Fc1cccc(SBr)c1.
What is the InChIKey of (3-fluorophenyl) thiohypobromite?
The InChIKey is XRSUWXXMFJKAQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrFS/c7-9-6-3-1-2-5(8)4-6/h1-4H.
What are the key properties of (3-fluorophenyl) thiohypobromite?
(3-fluorophenyl) thiohypobromite has a molecular weight of 207.07 g/mol, XLogP of 3.23, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3-fluorophenyl) thiohypobromite is sourced from PubChem (CID 173469120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).