C48H39NO2 — CID 173472404
3-[(E)-3-[6-[(6-tert-butylnaphthalen-2-yl)-naphthalen-1-ylamino]-3,4-dihydronaphthalen-2-yl]prop-2-enoyl]naphthalene-2-carbaldehyde (PubChem CID 173472404) has the molecular formula C48H39NO2 and a molecular weight of 661.85 g/mol. Its IUPAC name is 3-[(E)-3-[6-[(6-tert-butylnaphthalen-2-yl)-naphthalen-1-ylamino]-3,4-dihydronaphthalen-2-yl]prop-2-enoyl]naphthalene-2-carbaldehyde.
| Compound Name | 3-[(E)-3-[6-[(6-tert-butylnaphthalen-2-yl)-naphthalen-1-ylamino]-3,4-dihydronaphthalen-2-yl]prop-2-enoyl]naphthalene-2-carbaldehyde |
|---|---|
| PubChem CID | 173472404 |
| Molecular Formula | C48H39NO2 |
| Molecular Weight | 661.85 g/mol |
| Exact Mass | 661.30 |
| IUPAC Name | 3-[(E)-3-[6-[(6-tert-butylnaphthalen-2-yl)-naphthalen-1-ylamino]-3,4-dihydronaphthalen-2-yl]prop-2-enoyl]naphthalene-2-carbaldehyde |
| SMILES | CC(C)(C)c1ccc2cc(N(c3ccc4c(c3)CCC(/C=C/C(=O)c3cc5ccccc5cc3C=O)=C4)c3cccc4ccccc34)ccc2c1 |
| InChI | InChI=1S/C48H39NO2/c1-48(2,3)41-21-18-39-29-43(23-20-37(39)27-41)49(46-14-8-12-33-9-6-7-13-44(33)46)42-22-19-36-25-32(15-17-38(36)28-42)16-24-47(51)45-30-35-11-5-4-10-34(35)26-40(45)31-50/h4-14,16,18-31H,15,17H2,1-3H3/b24-16+ |
| InChIKey | VFLKQKSLDPNBPV-LFVJCYFKSA-N |
| XLogP | 12.49 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.85 |
| LogP ≤ 5 | 12.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|