C50H39NO2 — CID 173476763
3-[(Z)-3-[4-[bis(9,9-dimethylfluoren-2-yl)amino]phenyl]prop-2-enoyl]naphthalene-2-carbaldehyde (PubChem CID 173476763) has the molecular formula C50H39NO2 and a molecular weight of 685.87 g/mol. Its IUPAC name is 3-[(Z)-3-[4-[bis(9,9-dimethylfluoren-2-yl)amino]phenyl]prop-2-enoyl]naphthalene-2-carbaldehyde.
| Compound Name | 3-[(Z)-3-[4-[bis(9,9-dimethylfluoren-2-yl)amino]phenyl]prop-2-enoyl]naphthalene-2-carbaldehyde |
|---|---|
| PubChem CID | 173476763 |
| Molecular Formula | C50H39NO2 |
| Molecular Weight | 685.87 g/mol |
| Exact Mass | 685.30 |
| IUPAC Name | 3-[(Z)-3-[4-[bis(9,9-dimethylfluoren-2-yl)amino]phenyl]prop-2-enoyl]naphthalene-2-carbaldehyde |
| SMILES | CC1(C)c2ccccc2-c2ccc(N(c3ccc(/C=C\C(=O)c4cc5ccccc5cc4C=O)cc3)c3ccc4c(c3)C(C)(C)c3ccccc3-4)cc21 |
| InChI | InChI=1S/C50H39NO2/c1-49(2)44-15-9-7-13-39(44)41-24-22-37(29-46(41)49)51(38-23-25-42-40-14-8-10-16-45(40)50(3,4)47(42)30-38)36-20-17-32(18-21-36)19-26-48(53)43-28-34-12-6-5-11-33(34)27-35(43)31-52/h5-31H,1-4H3/b26-19- |
| InChIKey | AWNZYTFXBXZHLM-XHPQRKPJSA-N |
| XLogP | 12.63 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.87 |
| LogP ≤ 5 | 12.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|