About CID 173474861
CID 173474861 (PubChem CID 173474861) has the molecular formula C60H51Si
and a molecular weight of 800.15 g/mol.
Molecular Properties
| Compound Name | CID 173474861 |
| PubChem CID | 173474861 |
| Molecular Formula | C60H51Si |
| Molecular Weight | 800.15 g/mol |
| Exact Mass | 799.38 |
| IUPAC Name | — |
| SMILES | Cc1cccc(-c2cc(-c3cccc(C)c3)cc([Si](c3cc(-c4cccc(C)c4)cc(-c4cccc(C)c4)c3)c3cc(-c4cccc(C)c4)cc(-c4cccc(C)c4)c3)c2)c1 |
| InChI | InChI=1S/C60H51Si/c1-40-13-7-19-46(25-40)52-31-53(47-20-8-14-41(2)26-47)35-58(34-52)61(59-36-54(48-21-9-15-42(3)27-48)32-55(37-59)49-22-10-16-43(4)28-49)60-38-56(50-23-11-17-44(5)29-50)33-57(39-60)51-24-12-18-45(6)30-51/h7-39H,1-6H3 |
| InChIKey | RYGLTBVJCONPFZ-UHFFFAOYSA-N |
| XLogP | 14.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 61 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 800.15 |
| LogP ≤ 5 | 14.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze CID 173474861 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173474861?
The IUPAC name of CID 173474861 (CID 173474861) is not available.
What is the SMILES notation for CID 173474861?
The canonical SMILES for CID 173474861 is Cc1cccc(-c2cc(-c3cccc(C)c3)cc([Si](c3cc(-c4cccc(C)c4)cc(-c4cccc(C)c4)c3)c3cc(-c4cccc(C)c4)cc(-c4cccc(C)c4)c3)c2)c1.
What is the InChIKey of CID 173474861?
The InChIKey is RYGLTBVJCONPFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C60H51Si/c1-40-13-7-19-46(25-40)52-31-53(47-20-8-14-41(2)26-47)35-58(34-52)61(59-36-54(48-21-9-15-42(3)27-48)32-55(37-59)49-22-10-16-43(4)28-49)60-38-56(50-23-11-17-44(5)29-50)33-57(39-60)51-24-12-18-45(6)30-51/h7-39H,1-6H3.
What are the key properties of CID 173474861?
CID 173474861 has a molecular weight of 800.15 g/mol, XLogP of 14.06, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173474861 is sourced from PubChem (CID 173474861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).