C22H28FN7O5S — CID 173475339
N'-[(1E)-1-(2-fluoro-4-methylsulfonylanilino)-2-nitro-3-[4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]buta-1,3-dienyl]methanimidamide (PubChem CID 173475339) has the molecular formula C22H28FN7O5S and a molecular weight of 521.58 g/mol. Its IUPAC name is N'-[(1E)-1-(2-fluoro-4-methylsulfonylanilino)-2-nitro-3-[4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]buta-1,3-dienyl]methanimidamide.
| Compound Name | N'-[(1E)-1-(2-fluoro-4-methylsulfonylanilino)-2-nitro-3-[4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]buta-1,3-dienyl]methanimidamide |
|---|---|
| PubChem CID | 173475339 |
| Molecular Formula | C22H28FN7O5S |
| Molecular Weight | 521.58 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | N'-[(1E)-1-(2-fluoro-4-methylsulfonylanilino)-2-nitro-3-[4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]buta-1,3-dienyl]methanimidamide |
| SMILES | C=C(/C(=C(\N=CN)Nc1ccc(S(C)(=O)=O)cc1F)[N+](=O)[O-])N1CCC(c2nc(C(C)C)no2)CC1 |
| InChI | InChI=1S/C22H28FN7O5S/c1-13(2)20-27-22(35-28-20)15-7-9-29(10-8-15)14(3)19(30(31)32)21(25-12-24)26-18-6-5-16(11-17(18)23)36(4,33)34/h5-6,11-13,15,26H,3,7-10H2,1-2,4H3,(H2,24,25)/b21-19- |
| InChIKey | XJGJPQYIBCZCRR-VZCXRCSSSA-N |
| XLogP | 2.97 |
| TPSA | 169.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.58 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|