C23H26FN7O6S — CID 46847399
(Z)-1-(2-fluoro-4-methylsulfonylphenyl)-N-[5-nitro-6-[4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]pyrimidin-4-yl]oxyethanimine (PubChem CID 46847399) has the molecular formula C23H26FN7O6S and a molecular weight of 547.57 g/mol. Its IUPAC name is (Z)-1-(2-fluoro-4-methylsulfonylphenyl)-N-[5-nitro-6-[4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]pyrimidin-4-yl]oxyethanimine.
| Compound Name | (Z)-1-(2-fluoro-4-methylsulfonylphenyl)-N-[5-nitro-6-[4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]pyrimidin-4-yl]oxyethanimine |
|---|---|
| PubChem CID | 46847399 |
| Molecular Formula | C23H26FN7O6S |
| Molecular Weight | 547.57 g/mol |
| Exact Mass | 547.16 |
| IUPAC Name | (Z)-1-(2-fluoro-4-methylsulfonylphenyl)-N-[5-nitro-6-[4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]pyrimidin-4-yl]oxyethanimine |
| SMILES | C/C(=N/Oc1ncnc(N2CCC(c3nc(C(C)C)no3)CC2)c1[N+](=O)[O-])c1ccc(S(C)(=O)=O)cc1F |
| InChI | InChI=1S/C23H26FN7O6S/c1-13(2)20-27-22(36-29-20)15-7-9-30(10-8-15)21-19(31(32)33)23(26-12-25-21)37-28-14(3)17-6-5-16(11-18(17)24)38(4,34)35/h5-6,11-13,15H,7-10H2,1-4H3/b28-14- |
| InChIKey | MOOTZFZVEZQYHG-MUXKCCDJSA-N |
| XLogP | 3.62 |
| TPSA | 166.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.57 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|