C23H27N7O5 — CID 46847300
(Z)-1-(4-methoxyphenyl)-N-[5-nitro-6-[4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]pyrimidin-4-yl]oxyethanimine (PubChem CID 46847300) has the molecular formula C23H27N7O5 and a molecular weight of 481.51 g/mol. Its IUPAC name is (Z)-1-(4-methoxyphenyl)-N-[5-nitro-6-[4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]pyrimidin-4-yl]oxyethanimine.
| Compound Name | (Z)-1-(4-methoxyphenyl)-N-[5-nitro-6-[4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]pyrimidin-4-yl]oxyethanimine |
|---|---|
| PubChem CID | 46847300 |
| Molecular Formula | C23H27N7O5 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | (Z)-1-(4-methoxyphenyl)-N-[5-nitro-6-[4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]pyrimidin-4-yl]oxyethanimine |
| SMILES | COc1ccc(/C(C)=N\Oc2ncnc(N3CCC(c4nc(C(C)C)no4)CC3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H27N7O5/c1-14(2)20-26-22(34-28-20)17-9-11-29(12-10-17)21-19(30(31)32)23(25-13-24-21)35-27-15(3)16-5-7-18(33-4)8-6-16/h5-8,13-14,17H,9-12H2,1-4H3/b27-15- |
| InChIKey | BUVRSIXJLJLLPK-DICXZTSXSA-N |
| XLogP | 4.09 |
| TPSA | 141.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|