C11H17O4PS — CID 173475510
(3-phenyl-5-sulfanylpentyl) dihydrogen phosphate (PubChem CID 173475510) has the molecular formula C11H17O4PS and a molecular weight of 276.29 g/mol. Its IUPAC name is (3-phenyl-5-sulfanylpentyl) dihydrogen phosphate.
| Compound Name | (3-phenyl-5-sulfanylpentyl) dihydrogen phosphate |
|---|---|
| PubChem CID | 173475510 |
| Molecular Formula | C11H17O4PS |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | (3-phenyl-5-sulfanylpentyl) dihydrogen phosphate |
| SMILES | O=P(O)(O)OCCC(CCS)c1ccccc1 |
| InChI | InChI=1S/C11H17O4PS/c12-16(13,14)15-8-6-11(7-9-17)10-4-2-1-3-5-10/h1-5,11,17H,6-9H2,(H2,12,13,14) |
| InChIKey | XOQYTFAPTXUOFP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|