C28H25N3O8 — CID 173477967
[4-hydroxy-3-[(2-methoxy-4-nitrophenyl)diazenyl]-5-(2-methoxyphenyl)-2-oxopent-3-enyl] 4-ethenylbenzoate (PubChem CID 173477967) has the molecular formula C28H25N3O8 and a molecular weight of 531.52 g/mol. Its IUPAC name is [4-hydroxy-3-[(2-methoxy-4-nitrophenyl)diazenyl]-5-(2-methoxyphenyl)-2-oxopent-3-enyl] 4-ethenylbenzoate.
| Compound Name | [4-hydroxy-3-[(2-methoxy-4-nitrophenyl)diazenyl]-5-(2-methoxyphenyl)-2-oxopent-3-enyl] 4-ethenylbenzoate |
|---|---|
| PubChem CID | 173477967 |
| Molecular Formula | C28H25N3O8 |
| Molecular Weight | 531.52 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | [4-hydroxy-3-[(2-methoxy-4-nitrophenyl)diazenyl]-5-(2-methoxyphenyl)-2-oxopent-3-enyl] 4-ethenylbenzoate |
| SMILES | C=Cc1ccc(C(=O)OCC(=O)C(/N=N/c2ccc([N+](=O)[O-])cc2OC)=C(O)Cc2ccccc2OC)cc1 |
| InChI | InChI=1S/C28H25N3O8/c1-4-18-9-11-19(12-10-18)28(34)39-17-24(33)27(23(32)15-20-7-5-6-8-25(20)37-2)30-29-22-14-13-21(31(35)36)16-26(22)38-3/h4-14,16,32H,1,15,17H2,2-3H3/b27-23?,30-29+ |
| InChIKey | WJBFJIHPGKGVFK-UEOWIJOCSA-N |
| XLogP | 5.78 |
| TPSA | 149.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.52 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|