C27H26N4O8 — CID 147160024
4-[(4-ethenylphenyl)-hydroxymethoxy]-3-hydroxy-2-[(2-methoxy-4-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)but-2-enamide (PubChem CID 147160024) has the molecular formula C27H26N4O8 and a molecular weight of 534.53 g/mol. Its IUPAC name is 4-[(4-ethenylphenyl)-hydroxymethoxy]-3-hydroxy-2-[(2-methoxy-4-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)but-2-enamide.
| Compound Name | 4-[(4-ethenylphenyl)-hydroxymethoxy]-3-hydroxy-2-[(2-methoxy-4-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)but-2-enamide |
|---|---|
| PubChem CID | 147160024 |
| Molecular Formula | C27H26N4O8 |
| Molecular Weight | 534.53 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | 4-[(4-ethenylphenyl)-hydroxymethoxy]-3-hydroxy-2-[(2-methoxy-4-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)but-2-enamide |
| SMILES | C=Cc1ccc(C(O)OCC(O)=C(/N=N/c2ccc([N+](=O)[O-])cc2OC)C(=O)Nc2ccccc2OC)cc1 |
| InChI | InChI=1S/C27H26N4O8/c1-4-17-9-11-18(12-10-17)27(34)39-16-22(32)25(26(33)28-20-7-5-6-8-23(20)37-2)30-29-21-14-13-19(31(35)36)15-24(21)38-3/h4-15,27,32,34H,1,16H2,2-3H3,(H,28,33)/b25-22?,30-29+ |
| InChIKey | WPKNBTWJWYGJCY-MILGNCQRSA-N |
| XLogP | 5.45 |
| TPSA | 165.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.53 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|