C20H24N4O4 — CID 152776775
2-[[5-(2-aminoethyl)-2-methoxyphenyl]diazenyl]-3-hydroxy-N-(2-methoxyphenyl)but-2-enamide (PubChem CID 152776775) has the molecular formula C20H24N4O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is 2-[[5-(2-aminoethyl)-2-methoxyphenyl]diazenyl]-3-hydroxy-N-(2-methoxyphenyl)but-2-enamide.
| Compound Name | 2-[[5-(2-aminoethyl)-2-methoxyphenyl]diazenyl]-3-hydroxy-N-(2-methoxyphenyl)but-2-enamide |
|---|---|
| PubChem CID | 152776775 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 2-[[5-(2-aminoethyl)-2-methoxyphenyl]diazenyl]-3-hydroxy-N-(2-methoxyphenyl)but-2-enamide |
| SMILES | COc1ccc(CCN)cc1/N=N/C(C(=O)Nc1ccccc1OC)=C(C)O |
| InChI | InChI=1S/C20H24N4O4/c1-13(25)19(20(26)22-15-6-4-5-7-17(15)27-2)24-23-16-12-14(10-11-21)8-9-18(16)28-3/h4-9,12,25H,10-11,21H2,1-3H3,(H,22,26)/b19-13?,24-23+ |
| InChIKey | DWDJAIQVOFKUBB-JQQPTBOUSA-N |
| XLogP | 3.72 |
| TPSA | 118.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|