C19H21N3O9S2 — CID 158434159
hydroperoxy 2-[4-[[3-hydroxy-1-(2-methoxyanilino)-1-oxobut-2-en-2-yl]diazenyl]phenyl]sulfonylethanesulfinate (PubChem CID 158434159) has the molecular formula C19H21N3O9S2 and a molecular weight of 499.52 g/mol. Its IUPAC name is hydroperoxy 2-[4-[[3-hydroxy-1-(2-methoxyanilino)-1-oxobut-2-en-2-yl]diazenyl]phenyl]sulfonylethanesulfinate.
| Compound Name | hydroperoxy 2-[4-[[3-hydroxy-1-(2-methoxyanilino)-1-oxobut-2-en-2-yl]diazenyl]phenyl]sulfonylethanesulfinate |
|---|---|
| PubChem CID | 158434159 |
| Molecular Formula | C19H21N3O9S2 |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 499.07 |
| IUPAC Name | hydroperoxy 2-[4-[[3-hydroxy-1-(2-methoxyanilino)-1-oxobut-2-en-2-yl]diazenyl]phenyl]sulfonylethanesulfinate |
| SMILES | COc1ccccc1NC(=O)C(/N=N/c1ccc(S(=O)(=O)CCS(=O)OOO)cc1)=C(C)O |
| InChI | InChI=1S/C19H21N3O9S2/c1-13(23)18(19(24)20-16-5-3-4-6-17(16)29-2)22-21-14-7-9-15(10-8-14)33(27,28)12-11-32(26)31-30-25/h3-10,23,25H,11-12H2,1-2H3,(H,20,24)/b18-13?,22-21+ |
| InChIKey | UDPXAMCTRZAQNW-FGMFMWQCSA-N |
| XLogP | 3.07 |
| TPSA | 173.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|