C19H24N2O6 — CID 173478356
dimethyl 2-[(Z)-2-amino-3-methyl-3-(phenylmethoxycarbonylamino)but-1-enyl]but-2-enedioate (PubChem CID 173478356) has the molecular formula C19H24N2O6 and a molecular weight of 376.41 g/mol. Its IUPAC name is dimethyl 2-[(Z)-2-amino-3-methyl-3-(phenylmethoxycarbonylamino)but-1-enyl]but-2-enedioate.
| Compound Name | dimethyl 2-[(Z)-2-amino-3-methyl-3-(phenylmethoxycarbonylamino)but-1-enyl]but-2-enedioate |
|---|---|
| PubChem CID | 173478356 |
| Molecular Formula | C19H24N2O6 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | dimethyl 2-[(Z)-2-amino-3-methyl-3-(phenylmethoxycarbonylamino)but-1-enyl]but-2-enedioate |
| SMILES | COC(=O)C=C(/C=C(\N)C(C)(C)NC(=O)OCc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C19H24N2O6/c1-19(2,21-18(24)27-12-13-8-6-5-7-9-13)15(20)10-14(17(23)26-4)11-16(22)25-3/h5-11H,12,20H2,1-4H3,(H,21,24)/b14-11?,15-10- |
| InChIKey | SADBKOLDXGKHRV-SMKRHZLGSA-N |
| XLogP | 1.81 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|