C10H11MoO- — CID 173480397
1-(2,6-dimethylbenzene-4-id-1-yl)ethanone;molybdenum (PubChem CID 173480397) has the molecular formula C10H11MoO- and a molecular weight of 243.14 g/mol. Its IUPAC name is 1-(2,6-dimethylbenzene-4-id-1-yl)ethanone;molybdenum.
| Compound Name | 1-(2,6-dimethylbenzene-4-id-1-yl)ethanone;molybdenum |
|---|---|
| PubChem CID | 173480397 |
| Molecular Formula | C10H11MoO- |
| Molecular Weight | 243.14 g/mol |
| Exact Mass | 244.99 |
| IUPAC Name | 1-(2,6-dimethylbenzene-4-id-1-yl)ethanone;molybdenum |
| SMILES | CC(=O)c1c(C)c[c-]cc1C.[Mo] |
| InChI | InChI=1S/C10H11O.Mo/c1-7-5-4-6-8(2)10(7)9(3)11;/h5-6H,1-3H3;/q-1; |
| InChIKey | FMRIWBMTOGZAFD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.14 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|