C29H33NO5Sr — CID 173480507
strontium;N-[(4S,5S)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-3,4,5,6-tetrahydro-2H-pyran-2-id-3-yl]acetamide;hydride (PubChem CID 173480507) has the molecular formula C29H33NO5Sr and a molecular weight of 563.21 g/mol. Its IUPAC name is strontium;N-[(4S,5S)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-3,4,5,6-tetrahydro-2H-pyran-2-id-3-yl]acetamide;hydride.
| Compound Name | strontium;N-[(4S,5S)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-3,4,5,6-tetrahydro-2H-pyran-2-id-3-yl]acetamide;hydride |
|---|---|
| PubChem CID | 173480507 |
| Molecular Formula | C29H33NO5Sr |
| Molecular Weight | 563.21 g/mol |
| Exact Mass | 563.14 |
| IUPAC Name | strontium;N-[(4S,5S)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-3,4,5,6-tetrahydro-2H-pyran-2-id-3-yl]acetamide;hydride |
| SMILES | CC(=O)NC1[CH-]OC(COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]1OCc1ccccc1.[H-].[Sr+2] |
| InChI | InChI=1S/C29H32NO5.Sr.H/c1-22(31)30-26-20-33-27(21-32-17-23-11-5-2-6-12-23)29(35-19-25-15-9-4-10-16-25)28(26)34-18-24-13-7-3-8-14-24;;/h2-16,20,26-29H,17-19,21H2,1H3,(H,30,31);;/q-1;+2;-1/t26?,27?,28-,29+;;/m0../s1 |
| InChIKey | RNPOLDJRJYEWPC-GLWVZRRQSA-N |
| XLogP | 4.17 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.21 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|