C16H24N2O2 — CID 173481763
1-(2,6-dimethoxyphenyl)-N-(1-ethylpyrrolidin-2-yl)ethanimine (PubChem CID 173481763) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 1-(2,6-dimethoxyphenyl)-N-(1-ethylpyrrolidin-2-yl)ethanimine.
| Compound Name | 1-(2,6-dimethoxyphenyl)-N-(1-ethylpyrrolidin-2-yl)ethanimine |
|---|---|
| PubChem CID | 173481763 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 1-(2,6-dimethoxyphenyl)-N-(1-ethylpyrrolidin-2-yl)ethanimine |
| SMILES | CCN1CCCC1N=C(C)c1c(OC)cccc1OC |
| InChI | InChI=1S/C16H24N2O2/c1-5-18-11-7-10-15(18)17-12(2)16-13(19-3)8-6-9-14(16)20-4/h6,8-9,15H,5,7,10-11H2,1-4H3 |
| InChIKey | BDZDPSVUTIXRFZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|