C20H20FN5O4 — CID 173482012
N-[[(5S)-3-[4-[4-(azidomethyl)-2-methoxyphenyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 173482012) has the molecular formula C20H20FN5O4 and a molecular weight of 413.41 g/mol. Its IUPAC name is N-[[(5S)-3-[4-[4-(azidomethyl)-2-methoxyphenyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-[4-[4-(azidomethyl)-2-methoxyphenyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 173482012 |
| Molecular Formula | C20H20FN5O4 |
| Molecular Weight | 413.41 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | N-[[(5S)-3-[4-[4-(azidomethyl)-2-methoxyphenyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | COc1cc(CN=[N+]=[N-])ccc1-c1ccc(N2C[C@H](CNC(C)=O)OC2=O)cc1F |
| InChI | InChI=1S/C20H20FN5O4/c1-12(27)23-10-15-11-26(20(28)30-15)14-4-6-16(18(21)8-14)17-5-3-13(9-24-25-22)7-19(17)29-2/h3-8,15H,9-11H2,1-2H3,(H,23,27)/t15-/m0/s1 |
| InChIKey | FGIICCIHYXLZFY-HNNXBMFYSA-N |
| XLogP | 3.77 |
| TPSA | 116.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|