C19H20F6IN2O2P — CID 173482222
(5R)-5-[[(2S)-1-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-phosphanylbut-3-en-2-yl]iminomethyl]-5-iodopyrrolidin-2-one (PubChem CID 173482222) has the molecular formula C19H20F6IN2O2P and a molecular weight of 580.25 g/mol. Its IUPAC name is (5R)-5-[[(2S)-1-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-phosphanylbut-3-en-2-yl]iminomethyl]-5-iodopyrrolidin-2-one.
| Compound Name | (5R)-5-[[(2S)-1-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-phosphanylbut-3-en-2-yl]iminomethyl]-5-iodopyrrolidin-2-one |
|---|---|
| PubChem CID | 173482222 |
| Molecular Formula | C19H20F6IN2O2P |
| Molecular Weight | 580.25 g/mol |
| Exact Mass | 580.02 |
| IUPAC Name | (5R)-5-[[(2S)-1-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-phosphanylbut-3-en-2-yl]iminomethyl]-5-iodopyrrolidin-2-one |
| SMILES | C=C[C@](P)(CO[C@H](C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)N=C[C@]1(I)CCC(=O)N1 |
| InChI | InChI=1S/C19H20F6IN2O2P/c1-3-17(31,27-9-16(26)5-4-15(29)28-16)10-30-11(2)12-6-13(18(20,21)22)8-14(7-12)19(23,24)25/h3,6-9,11H,1,4-5,10,31H2,2H3,(H,28,29)/t11-,16+,17+/m1/s1 |
| InChIKey | BNYCGYFHPKPSTG-NVGVWMPQSA-N |
| XLogP | 5.67 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.25 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|