C19H28IN2O2P — CID 89090978
(5R)-5-[[[(2S)-1-[(1R)-1-(3,5-dimethylphenyl)ethoxy]-2-phosphanylbut-3-en-2-yl]amino]methyl]-5-iodopyrrolidin-2-one (PubChem CID 89090978) has the molecular formula C19H28IN2O2P and a molecular weight of 474.32 g/mol. Its IUPAC name is (5R)-5-[[[(2S)-1-[(1R)-1-(3,5-dimethylphenyl)ethoxy]-2-phosphanylbut-3-en-2-yl]amino]methyl]-5-iodopyrrolidin-2-one.
| Compound Name | (5R)-5-[[[(2S)-1-[(1R)-1-(3,5-dimethylphenyl)ethoxy]-2-phosphanylbut-3-en-2-yl]amino]methyl]-5-iodopyrrolidin-2-one |
|---|---|
| PubChem CID | 89090978 |
| Molecular Formula | C19H28IN2O2P |
| Molecular Weight | 474.32 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | (5R)-5-[[[(2S)-1-[(1R)-1-(3,5-dimethylphenyl)ethoxy]-2-phosphanylbut-3-en-2-yl]amino]methyl]-5-iodopyrrolidin-2-one |
| SMILES | C=C[C@](P)(CO[C@H](C)c1cc(C)cc(C)c1)NC[C@]1(I)CCC(=O)N1 |
| InChI | InChI=1S/C19H28IN2O2P/c1-5-19(25,21-11-18(20)7-6-17(23)22-18)12-24-15(4)16-9-13(2)8-14(3)10-16/h5,8-10,15,21H,1,6-7,11-12,25H2,2-4H3,(H,22,23)/t15-,18+,19+/m1/s1 |
| InChIKey | DUEITNRVWZKVEQ-MNEFBYGVSA-N |
| XLogP | 3.77 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.32 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|