About (E)-3-amino-2-[N'-(1-chloroethenyl)carbamimidoyl]prop-2-enoic acid
(E)-3-amino-2-[N'-(1-chloroethenyl)carbamimidoyl]prop-2-enoic acid (PubChem CID 173483305) has the molecular formula C6H8ClN3O2
and a molecular weight of 189.60 g/mol. Its IUPAC name is (E)-3-amino-2-[N'-(1-chloroethenyl)carbamimidoyl]prop-2-enoic acid.
Molecular Properties
| Compound Name | (E)-3-amino-2-[N'-(1-chloroethenyl)carbamimidoyl]prop-2-enoic acid |
| PubChem CID | 173483305 |
| Molecular Formula | C6H8ClN3O2 |
| Molecular Weight | 189.60 g/mol |
| Exact Mass | 189.03 |
| IUPAC Name | (E)-3-amino-2-[N'-(1-chloroethenyl)carbamimidoyl]prop-2-enoic acid |
| SMILES | C=C(Cl)N=C(N)/C(=C\N)C(=O)O |
| InChI | InChI=1S/C6H8ClN3O2/c1-3(7)10-5(9)4(2-8)6(11)12/h2H,1,8H2,(H2,9,10)(H,11,12)/b4-2+ |
| InChIKey | ONWYARSSJRQMFX-DUXPYHPUSA-N |
| XLogP | -0.02 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.60 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-amino-2-[N'-(1-chloroethenyl)carbamimidoyl]prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-amino-2-[N'-(1-chloroethenyl)carbamimidoyl]prop-2-enoic acid?
The IUPAC name of (E)-3-amino-2-[N'-(1-chloroethenyl)carbamimidoyl]prop-2-enoic acid (CID 173483305) is (E)-3-amino-2-[N'-(1-chloroethenyl)carbamimidoyl]prop-2-enoic acid.
What is the SMILES notation for (E)-3-amino-2-[N'-(1-chloroethenyl)carbamimidoyl]prop-2-enoic acid?
The canonical SMILES for (E)-3-amino-2-[N'-(1-chloroethenyl)carbamimidoyl]prop-2-enoic acid is C=C(Cl)N=C(N)/C(=C\N)C(=O)O.
What is the InChIKey of (E)-3-amino-2-[N'-(1-chloroethenyl)carbamimidoyl]prop-2-enoic acid?
The InChIKey is ONWYARSSJRQMFX-DUXPYHPUSA-N. The full InChI is InChI=1S/C6H8ClN3O2/c1-3(7)10-5(9)4(2-8)6(11)12/h2H,1,8H2,(H2,9,10)(H,11,12)/b4-2+.
What are the key properties of (E)-3-amino-2-[N'-(1-chloroethenyl)carbamimidoyl]prop-2-enoic acid?
(E)-3-amino-2-[N'-(1-chloroethenyl)carbamimidoyl]prop-2-enoic acid has a molecular weight of 189.60 g/mol, XLogP of -0.02, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-amino-2-[N'-(1-chloroethenyl)carbamimidoyl]prop-2-enoic acid is sourced from PubChem (CID 173483305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).