C5H7ClN2O2 — CID 142397783
(E,2E)-4-amino-2-(aminomethylidene)-4-chlorobut-3-enoic acid (PubChem CID 142397783) has the molecular formula C5H7ClN2O2 and a molecular weight of 162.58 g/mol. Its IUPAC name is (E,2E)-4-amino-2-(aminomethylidene)-4-chlorobut-3-enoic acid.
| Compound Name | (E,2E)-4-amino-2-(aminomethylidene)-4-chlorobut-3-enoic acid |
|---|---|
| PubChem CID | 142397783 |
| Molecular Formula | C5H7ClN2O2 |
| Molecular Weight | 162.58 g/mol |
| Exact Mass | 162.02 |
| IUPAC Name | (E,2E)-4-amino-2-(aminomethylidene)-4-chlorobut-3-enoic acid |
| SMILES | N/C=C(\C=C(/N)Cl)C(=O)O |
| InChI | InChI=1S/C5H7ClN2O2/c6-4(8)1-3(2-7)5(9)10/h1-2H,7-8H2,(H,9,10)/b3-2+,4-1- |
| InChIKey | GJRDVCGVYKZNLO-NAOWAUKJSA-N |
| XLogP | -0.05 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.58 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|