C14H25N7O3S — CID 173483459
4-[1-[(3S)-3-[[(2R)-2-hydrazinyl-3-sulfanylpropanoyl]amino]-4-oxopentyl]triazol-4-yl]butanamide (PubChem CID 173483459) has the molecular formula C14H25N7O3S and a molecular weight of 371.47 g/mol. Its IUPAC name is 4-[1-[(3S)-3-[[(2R)-2-hydrazinyl-3-sulfanylpropanoyl]amino]-4-oxopentyl]triazol-4-yl]butanamide.
| Compound Name | 4-[1-[(3S)-3-[[(2R)-2-hydrazinyl-3-sulfanylpropanoyl]amino]-4-oxopentyl]triazol-4-yl]butanamide |
|---|---|
| PubChem CID | 173483459 |
| Molecular Formula | C14H25N7O3S |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 4-[1-[(3S)-3-[[(2R)-2-hydrazinyl-3-sulfanylpropanoyl]amino]-4-oxopentyl]triazol-4-yl]butanamide |
| SMILES | CC(=O)[C@H](CCn1cc(CCCC(N)=O)nn1)NC(=O)[C@H](CS)NN |
| InChI | InChI=1S/C14H25N7O3S/c1-9(22)11(17-14(24)12(8-25)18-16)5-6-21-7-10(19-20-21)3-2-4-13(15)23/h7,11-12,18,25H,2-6,8,16H2,1H3,(H2,15,23)(H,17,24)/t11-,12-/m0/s1 |
| InChIKey | FPDUUSIQWJICMK-RYUDHWBXSA-N |
| XLogP | -1.69 |
| TPSA | 158.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|