C25H39N5O3 — CID 165055245
4-[1-(5-acetyl-7,7-dimethyloctyl)triazol-4-yl]-N-[2-(2-methylidene-5-oxopyrrol-1-yl)ethyl]butanamide (PubChem CID 165055245) has the molecular formula C25H39N5O3 and a molecular weight of 457.62 g/mol. Its IUPAC name is 4-[1-(5-acetyl-7,7-dimethyloctyl)triazol-4-yl]-N-[2-(2-methylidene-5-oxopyrrol-1-yl)ethyl]butanamide.
| Compound Name | 4-[1-(5-acetyl-7,7-dimethyloctyl)triazol-4-yl]-N-[2-(2-methylidene-5-oxopyrrol-1-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 165055245 |
| Molecular Formula | C25H39N5O3 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.31 |
| IUPAC Name | 4-[1-(5-acetyl-7,7-dimethyloctyl)triazol-4-yl]-N-[2-(2-methylidene-5-oxopyrrol-1-yl)ethyl]butanamide |
| SMILES | C=C1C=CC(=O)N1CCNC(=O)CCCc1cn(CCCCC(CC(C)(C)C)C(C)=O)nn1 |
| InChI | InChI=1S/C25H39N5O3/c1-19-12-13-24(33)30(19)16-14-26-23(32)11-8-10-22-18-29(28-27-22)15-7-6-9-21(20(2)31)17-25(3,4)5/h12-13,18,21H,1,6-11,14-17H2,2-5H3,(H,26,32) |
| InChIKey | ARFNLJZHKMTMDN-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|