C7H12Si — CID 173485389
(3-methylcyclohexa-1,3-dien-1-yl)silane (PubChem CID 173485389) has the molecular formula C7H12Si and a molecular weight of 124.26 g/mol. Its IUPAC name is (3-methylcyclohexa-1,3-dien-1-yl)silane.
| Compound Name | (3-methylcyclohexa-1,3-dien-1-yl)silane |
|---|---|
| PubChem CID | 173485389 |
| Molecular Formula | C7H12Si |
| Molecular Weight | 124.26 g/mol |
| Exact Mass | 124.07 |
| IUPAC Name | (3-methylcyclohexa-1,3-dien-1-yl)silane |
| SMILES | CC1=CCCC([SiH3])=C1 |
| InChI | InChI=1S/C7H12Si/c1-6-3-2-4-7(8)5-6/h3,5H,2,4H2,1,8H3 |
| InChIKey | ZPFGPMCOIHQZAL-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.26 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|