C6H11NaSi — CID 173341629
sodium;hydride;(3-methylcyclopenta-1,3-dien-1-yl)silane (PubChem CID 173341629) has the molecular formula C6H11NaSi and a molecular weight of 134.23 g/mol. Its IUPAC name is sodium;hydride;(3-methylcyclopenta-1,3-dien-1-yl)silane.
| Compound Name | sodium;hydride;(3-methylcyclopenta-1,3-dien-1-yl)silane |
|---|---|
| PubChem CID | 173341629 |
| Molecular Formula | C6H11NaSi |
| Molecular Weight | 134.23 g/mol |
| Exact Mass | 134.05 |
| IUPAC Name | sodium;hydride;(3-methylcyclopenta-1,3-dien-1-yl)silane |
| SMILES | CC1=CCC([SiH3])=C1.[H-].[Na+] |
| InChI | InChI=1S/C6H10Si.Na.H/c1-5-2-3-6(7)4-5;;/h2,4H,3H2,1,7H3;;/q;+1;-1 |
| InChIKey | FBGZGEFHIPYBST-UHFFFAOYSA-N |
| XLogP | -2.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.23 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|