C6H7I — CID 145094237
1-iodo-3-methylcyclopenta-1,3-diene (PubChem CID 145094237) has the molecular formula C6H7I and a molecular weight of 206.03 g/mol. Its IUPAC name is 1-iodo-3-methylcyclopenta-1,3-diene.
| Compound Name | 1-iodo-3-methylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 145094237 |
| Molecular Formula | C6H7I |
| Molecular Weight | 206.03 g/mol |
| Exact Mass | 205.96 |
| IUPAC Name | 1-iodo-3-methylcyclopenta-1,3-diene |
| SMILES | CC1=CCC(I)=C1 |
| InChI | InChI=1S/C6H7I/c1-5-2-3-6(7)4-5/h2,4H,3H2,1H3 |
| InChIKey | MBTNVUKAKGLBLF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.03 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|