C10H13Br — CID 142255845
2-bromo-1,3,5-trimethylcyclohepta-1,3,5-triene (PubChem CID 142255845) has the molecular formula C10H13Br and a molecular weight of 213.12 g/mol. Its IUPAC name is 2-bromo-1,3,5-trimethylcyclohepta-1,3,5-triene.
| Compound Name | 2-bromo-1,3,5-trimethylcyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 142255845 |
| Molecular Formula | C10H13Br |
| Molecular Weight | 213.12 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | 2-bromo-1,3,5-trimethylcyclohepta-1,3,5-triene |
| SMILES | CC1=CCC(C)=C(Br)C(C)=C1 |
| InChI | InChI=1S/C10H13Br/c1-7-4-5-8(2)10(11)9(3)6-7/h4,6H,5H2,1-3H3 |
| InChIKey | GAMWAPLLVDMALV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.12 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |