C10H12O — CID 144708324
3,6-dimethylcyclohepta-1,3,6-triene-1-carbaldehyde (PubChem CID 144708324) has the molecular formula C10H12O and a molecular weight of 148.20 g/mol. Its IUPAC name is 3,6-dimethylcyclohepta-1,3,6-triene-1-carbaldehyde.
| Compound Name | 3,6-dimethylcyclohepta-1,3,6-triene-1-carbaldehyde |
|---|---|
| PubChem CID | 144708324 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | 3,6-dimethylcyclohepta-1,3,6-triene-1-carbaldehyde |
| SMILES | CC1=CCC(C)=CC(C=O)=C1 |
| InChI | InChI=1S/C10H12O/c1-8-3-4-9(2)6-10(5-8)7-11/h3,5-7H,4H2,1-2H3 |
| InChIKey | MKYWHDPIBGMOPJ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|