About 5-bromo-2,7-dimethylcyclohepta-1,4,6-trien-1-amine
5-bromo-2,7-dimethylcyclohepta-1,4,6-trien-1-amine (PubChem CID 143187920) has the molecular formula C9H12BrN
and a molecular weight of 214.11 g/mol. Its IUPAC name is 5-bromo-2,7-dimethylcyclohepta-1,4,6-trien-1-amine.
Analyze 5-bromo-2,7-dimethylcyclohepta-1,4,6-trien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2,7-dimethylcyclohepta-1,4,6-trien-1-amine?
The IUPAC name of 5-bromo-2,7-dimethylcyclohepta-1,4,6-trien-1-amine (CID 143187920) is 5-bromo-2,7-dimethylcyclohepta-1,4,6-trien-1-amine.
What is the SMILES notation for 5-bromo-2,7-dimethylcyclohepta-1,4,6-trien-1-amine?
The canonical SMILES for 5-bromo-2,7-dimethylcyclohepta-1,4,6-trien-1-amine is CC1=CC(Br)=CCC(C)=C1N.
What is the InChIKey of 5-bromo-2,7-dimethylcyclohepta-1,4,6-trien-1-amine?
The InChIKey is HGKSDHVJRKTQPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12BrN/c1-6-3-4-8(10)5-7(2)9(6)11/h4-5H,3,11H2,1-2H3.
What are the key properties of 5-bromo-2,7-dimethylcyclohepta-1,4,6-trien-1-amine?
5-bromo-2,7-dimethylcyclohepta-1,4,6-trien-1-amine has a molecular weight of 214.11 g/mol, XLogP of 2.85, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2,7-dimethylcyclohepta-1,4,6-trien-1-amine is sourced from PubChem (CID 143187920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).