C22H30N2 — CID 123547850
1-(2,5,7-trimethylcyclohepta-1,4,6-trien-1-yl)-3-(2,4,6-trimethylphenyl)imidazolidine (PubChem CID 123547850) has the molecular formula C22H30N2 and a molecular weight of 322.50 g/mol. Its IUPAC name is 1-(2,5,7-trimethylcyclohepta-1,4,6-trien-1-yl)-3-(2,4,6-trimethylphenyl)imidazolidine.
| Compound Name | 1-(2,5,7-trimethylcyclohepta-1,4,6-trien-1-yl)-3-(2,4,6-trimethylphenyl)imidazolidine |
|---|---|
| PubChem CID | 123547850 |
| Molecular Formula | C22H30N2 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | 1-(2,5,7-trimethylcyclohepta-1,4,6-trien-1-yl)-3-(2,4,6-trimethylphenyl)imidazolidine |
| SMILES | CC1=CCC(C)=C(N2CCN(c3c(C)cc(C)cc3C)C2)C(C)=C1 |
| InChI | InChI=1S/C22H30N2/c1-15-7-8-17(3)21(18(4)11-15)23-9-10-24(14-23)22-19(5)12-16(2)13-20(22)6/h7,11-13H,8-10,14H2,1-6H3 |
| InChIKey | DFYWWNWBWIXYNQ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |