About (2E)-2-butan-2-ylidene-4,4-dimethylhexanenitrile
(2E)-2-butan-2-ylidene-4,4-dimethylhexanenitrile (PubChem CID 173486418) has the molecular formula C12H21N
and a molecular weight of 179.31 g/mol. Its IUPAC name is (2E)-2-butan-2-ylidene-4,4-dimethylhexanenitrile.
Molecular Properties
| Compound Name | (2E)-2-butan-2-ylidene-4,4-dimethylhexanenitrile |
| PubChem CID | 173486418 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | (2E)-2-butan-2-ylidene-4,4-dimethylhexanenitrile |
| SMILES | CC/C(C)=C(/C#N)CC(C)(C)CC |
| InChI | InChI=1S/C12H21N/c1-6-10(3)11(9-13)8-12(4,5)7-2/h6-8H2,1-5H3/b11-10+ |
| InChIKey | CVHIDORLDQECRT-ZHACJKMWSA-N |
| XLogP | 4.06 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-butan-2-ylidene-4,4-dimethylhexanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-butan-2-ylidene-4,4-dimethylhexanenitrile?
The IUPAC name of (2E)-2-butan-2-ylidene-4,4-dimethylhexanenitrile (CID 173486418) is (2E)-2-butan-2-ylidene-4,4-dimethylhexanenitrile.
What is the SMILES notation for (2E)-2-butan-2-ylidene-4,4-dimethylhexanenitrile?
The canonical SMILES for (2E)-2-butan-2-ylidene-4,4-dimethylhexanenitrile is CC/C(C)=C(/C#N)CC(C)(C)CC.
What is the InChIKey of (2E)-2-butan-2-ylidene-4,4-dimethylhexanenitrile?
The InChIKey is CVHIDORLDQECRT-ZHACJKMWSA-N. The full InChI is InChI=1S/C12H21N/c1-6-10(3)11(9-13)8-12(4,5)7-2/h6-8H2,1-5H3/b11-10+.
What are the key properties of (2E)-2-butan-2-ylidene-4,4-dimethylhexanenitrile?
(2E)-2-butan-2-ylidene-4,4-dimethylhexanenitrile has a molecular weight of 179.31 g/mol, XLogP of 4.06, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-butan-2-ylidene-4,4-dimethylhexanenitrile is sourced from PubChem (CID 173486418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).