About CID 173486612
CID 173486612 (PubChem CID 173486612) has the molecular formula C10H17B
and a molecular weight of 148.06 g/mol.
Molecular Properties
| Compound Name | CID 173486612 |
| PubChem CID | 173486612 |
| Molecular Formula | C10H17B |
| Molecular Weight | 148.06 g/mol |
| Exact Mass | 148.14 |
| IUPAC Name | — |
| SMILES | [B]C(CC(C=C)CC)=C(C)C |
| InChI | InChI=1S/C10H17B/c1-5-9(6-2)7-10(11)8(3)4/h5,9H,1,6-7H2,2-4H3 |
| InChIKey | XIHQQZOLBIBVTQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.06 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 173486612 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173486612?
The IUPAC name of CID 173486612 (CID 173486612) is not available.
What is the SMILES notation for CID 173486612?
The canonical SMILES for CID 173486612 is [B]C(CC(C=C)CC)=C(C)C.
What is the InChIKey of CID 173486612?
The InChIKey is XIHQQZOLBIBVTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17B/c1-5-9(6-2)7-10(11)8(3)4/h5,9H,1,6-7H2,2-4H3.
What are the key properties of CID 173486612?
CID 173486612 has a molecular weight of 148.06 g/mol, XLogP of 3.05, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173486612 is sourced from PubChem (CID 173486612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).