C36H40AmN3O6+ — CID 173486788
americium;[9-[4-(carboxymethylamino)-3-[2-(2-ethyl-5-methoxyphenoxy)ethoxy]phenyl]-6-(methylaminomethyl)xanthen-3-ylidene]-dimethylazanium (PubChem CID 173486788) has the molecular formula C36H40AmN3O6+ and a molecular weight of 853.73 g/mol. Its IUPAC name is americium;[9-[4-(carboxymethylamino)-3-[2-(2-ethyl-5-methoxyphenoxy)ethoxy]phenyl]-6-(methylaminomethyl)xanthen-3-ylidene]-dimethylazanium.
| Compound Name | americium;[9-[4-(carboxymethylamino)-3-[2-(2-ethyl-5-methoxyphenoxy)ethoxy]phenyl]-6-(methylaminomethyl)xanthen-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 173486788 |
| Molecular Formula | C36H40AmN3O6+ |
| Molecular Weight | 853.73 g/mol |
| Exact Mass | 851.35 |
| IUPAC Name | americium;[9-[4-(carboxymethylamino)-3-[2-(2-ethyl-5-methoxyphenoxy)ethoxy]phenyl]-6-(methylaminomethyl)xanthen-3-ylidene]-dimethylazanium |
| SMILES | CCc1ccc(OC)cc1OCCOc1cc(-c2c3ccc(=[N+](C)C)cc-3oc3cc(CNC)ccc23)ccc1NCC(=O)O.[Am] |
| InChI | InChI=1S/C36H39N3O6.Am/c1-6-24-8-11-27(42-5)20-31(24)43-15-16-44-34-18-25(9-14-30(34)38-22-35(40)41)36-28-12-7-23(21-37-2)17-32(28)45-33-19-26(39(3)4)10-13-29(33)36;/h7-14,17-20,37H,6,15-16,21-22H2,1-5H3,(H,40,41);/p+1 |
| InChIKey | WENRXIGGOHCXMW-UHFFFAOYSA-O |
| XLogP | 5.48 |
| TPSA | 105.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.73 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|