C22H21I — CID 173487014
(3E)-2-ethylidene-3-[(E)-3-(4-iodophenyl)prop-2-enylidene]-1,1-dimethylindene (PubChem CID 173487014) has the molecular formula C22H21I and a molecular weight of 412.31 g/mol. Its IUPAC name is (3E)-2-ethylidene-3-[(E)-3-(4-iodophenyl)prop-2-enylidene]-1,1-dimethylindene.
| Compound Name | (3E)-2-ethylidene-3-[(E)-3-(4-iodophenyl)prop-2-enylidene]-1,1-dimethylindene |
|---|---|
| PubChem CID | 173487014 |
| Molecular Formula | C22H21I |
| Molecular Weight | 412.31 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | (3E)-2-ethylidene-3-[(E)-3-(4-iodophenyl)prop-2-enylidene]-1,1-dimethylindene |
| SMILES | CC=C1/C(=C\C=C\c2ccc(I)cc2)c2ccccc2C1(C)C |
| InChI | InChI=1S/C22H21I/c1-4-20-18(10-7-8-16-12-14-17(23)15-13-16)19-9-5-6-11-21(19)22(20,2)3/h4-15H,1-3H3/b8-7+,18-10-,20-4? |
| InChIKey | VTZMBSVHDHNZFM-ORLAMNFESA-N |
| XLogP | 6.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.31 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|