C26H19I — CID 89138231
(3'E)-3'-[(Z)-but-2-enylidene]-6'-iodo-2'-methylidenespiro[fluorene-9,1'-indene] (PubChem CID 89138231) has the molecular formula C26H19I and a molecular weight of 458.34 g/mol. Its IUPAC name is (3'E)-3'-[(Z)-but-2-enylidene]-6'-iodo-2'-methylidenespiro[fluorene-9,1'-indene].
| Compound Name | (3'E)-3'-[(Z)-but-2-enylidene]-6'-iodo-2'-methylidenespiro[fluorene-9,1'-indene] |
|---|---|
| PubChem CID | 89138231 |
| Molecular Formula | C26H19I |
| Molecular Weight | 458.34 g/mol |
| Exact Mass | 458.05 |
| IUPAC Name | (3'E)-3'-[(Z)-but-2-enylidene]-6'-iodo-2'-methylidenespiro[fluorene-9,1'-indene] |
| SMILES | C=C1/C(=C\C=C/C)c2ccc(I)cc2C12c1ccccc1-c1ccccc12 |
| InChI | InChI=1S/C26H19I/c1-3-4-9-19-17(2)26(25-16-18(27)14-15-22(19)25)23-12-7-5-10-20(23)21-11-6-8-13-24(21)26/h3-16H,2H2,1H3/b4-3-,19-9+ |
| InChIKey | RWTYAVGDUHSNRK-IJYIPRFUSA-N |
| XLogP | 7.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.34 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|